About 2-(1,4-diazepan-1-yl)-1,3-thiazole
2-(1,4-diazepan-1-yl)-1,3-thiazole (PubChem CID 16783263) has the molecular formula C8H13N3S
and a molecular weight of 183.28 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(1,4-diazepan-1-yl)-1,3-thiazole |
| PubChem CID | 16783263 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-1,3-thiazole |
| SMILES | c1csc(N2CCCNCC2)n1 |
| InChI | InChI=1S/C8H13N3S/c1-2-9-3-6-11(5-1)8-10-4-7-12-8/h4,7,9H,1-3,5-6H2 |
| InChIKey | YFODOQRAEQFQHL-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,4-diazepan-1-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazepan-1-yl)-1,3-thiazole?
The IUPAC name of 2-(1,4-diazepan-1-yl)-1,3-thiazole (CID 16783263) is 2-(1,4-diazepan-1-yl)-1,3-thiazole.
What is the SMILES notation for 2-(1,4-diazepan-1-yl)-1,3-thiazole?
The canonical SMILES for 2-(1,4-diazepan-1-yl)-1,3-thiazole is c1csc(N2CCCNCC2)n1.
What is the InChIKey of 2-(1,4-diazepan-1-yl)-1,3-thiazole?
The InChIKey is YFODOQRAEQFQHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3S/c1-2-9-3-6-11(5-1)8-10-4-7-12-8/h4,7,9H,1-3,5-6H2.
What are the key properties of 2-(1,4-diazepan-1-yl)-1,3-thiazole?
2-(1,4-diazepan-1-yl)-1,3-thiazole has a molecular weight of 183.28 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazepan-1-yl)-1,3-thiazole is sourced from PubChem (CID 16783263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).