C22H27N7O5 — CID 167832973
2-[[1-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]-2-(2-ethoxyethoxy)ethyl]amino]-N-(pyridin-2-ylmethyl)acetamide (PubChem CID 167832973) has the molecular formula C22H27N7O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is 2-[[1-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]-2-(2-ethoxyethoxy)ethyl]amino]-N-(pyridin-2-ylmethyl)acetamide.
| Compound Name | 2-[[1-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]-2-(2-ethoxyethoxy)ethyl]amino]-N-(pyridin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 167832973 |
| Molecular Formula | C22H27N7O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 2-[[1-[1-(1,3-benzodioxol-5-yl)tetrazol-5-yl]-2-(2-ethoxyethoxy)ethyl]amino]-N-(pyridin-2-ylmethyl)acetamide |
| SMILES | CCOCCOCC(NCC(=O)NCc1ccccn1)c1nnnn1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H27N7O5/c1-2-31-9-10-32-14-18(24-13-21(30)25-12-16-5-3-4-8-23-16)22-26-27-28-29(22)17-6-7-19-20(11-17)34-15-33-19/h3-8,11,18,24H,2,9-10,12-15H2,1H3,(H,25,30) |
| InChIKey | JOXUQBUSBVMERM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 134.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|