About 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate
2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate (PubChem CID 167834455) has the molecular formula C16H12ClN5O3
and a molecular weight of 357.76 g/mol. Its IUPAC name is 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate |
| PubChem CID | 167834455 |
| Molecular Formula | C16H12ClN5O3 |
| Molecular Weight | 357.76 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate |
| SMILES | N#Cc1cccnc1NCCOC(=O)c1cc(Cl)c2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H12ClN5O3/c17-11-6-10(7-12-13(11)22-16(24)21-12)15(23)25-5-4-20-14-9(8-18)2-1-3-19-14/h1-3,6-7H,4-5H2,(H,19,20)(H2,21,22,24) |
| InChIKey | SREZSIYAMCUOJW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.76 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate?
The IUPAC name of 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate (CID 167834455) is 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate.
What is the SMILES notation for 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate?
The canonical SMILES for 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate is N#Cc1cccnc1NCCOC(=O)c1cc(Cl)c2[nH]c(=O)[nH]c2c1.
What is the InChIKey of 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate?
The InChIKey is SREZSIYAMCUOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClN5O3/c17-11-6-10(7-12-13(11)22-16(24)21-12)15(23)25-5-4-20-14-9(8-18)2-1-3-19-14/h1-3,6-7H,4-5H2,(H,19,20)(H2,21,22,24).
What are the key properties of 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate?
2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate has a molecular weight of 357.76 g/mol, XLogP of 2.05, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-cyano-2-pyridinyl)amino]ethyl 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylate is sourced from PubChem (CID 167834455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).