About 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea
1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea (PubChem CID 167835718) has the molecular formula C15H15N3O4
and a molecular weight of 301.30 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea.
Molecular Properties
| Compound Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea |
| PubChem CID | 167835718 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea |
| SMILES | O=C(NCc1cc(=O)c(O)co1)Nc1ccc2c(n1)CCC2 |
| InChI | InChI=1S/C15H15N3O4/c19-12-6-10(22-8-13(12)20)7-16-15(21)18-14-5-4-9-2-1-3-11(9)17-14/h4-6,8,20H,1-3,7H2,(H2,16,17,18,21) |
| InChIKey | ZQZOENGNVLEWLX-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea?
The IUPAC name of 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea (CID 167835718) is 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea.
What is the SMILES notation for 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea?
The canonical SMILES for 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea is O=C(NCc1cc(=O)c(O)co1)Nc1ccc2c(n1)CCC2.
What is the InChIKey of 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea?
The InChIKey is ZQZOENGNVLEWLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O4/c19-12-6-10(22-8-13(12)20)7-16-15(21)18-14-5-4-9-2-1-3-11(9)17-14/h4-6,8,20H,1-3,7H2,(H2,16,17,18,21).
What are the key properties of 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea?
1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea has a molecular weight of 301.30 g/mol, XLogP of 1.55, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)-3-[(5-hydroxy-4-oxopyran-2-yl)methyl]urea is sourced from PubChem (CID 167835718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).