C19H19N3O2S — CID 167835937
N-(2-oxo-3H-1,3-benzothiazol-6-yl)-4-piperidin-3-ylbenzamide (PubChem CID 167835937) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is N-(2-oxo-3H-1,3-benzothiazol-6-yl)-4-piperidin-3-ylbenzamide.
| Compound Name | N-(2-oxo-3H-1,3-benzothiazol-6-yl)-4-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 167835937 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-(2-oxo-3H-1,3-benzothiazol-6-yl)-4-piperidin-3-ylbenzamide |
| SMILES | O=C(Nc1ccc2[nH]c(=O)sc2c1)c1ccc(C2CCCNC2)cc1 |
| InChI | InChI=1S/C19H19N3O2S/c23-18(21-15-7-8-16-17(10-15)25-19(24)22-16)13-5-3-12(4-6-13)14-2-1-9-20-11-14/h3-8,10,14,20H,1-2,9,11H2,(H,21,23)(H,22,24) |
| InChIKey | GIDNMTPLKSVUGR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |