About 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine
4-(2,6-dimethylmorpholin-4-yl)butan-2-amine (PubChem CID 16783784) has the molecular formula C10H22N2O
and a molecular weight of 186.30 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine.
Molecular Properties
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine |
| PubChem CID | 16783784 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine |
| SMILES | CC(N)CCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C10H22N2O/c1-8(11)4-5-12-6-9(2)13-10(3)7-12/h8-10H,4-7,11H2,1-3H3 |
| InChIKey | KXDWRBIAWWLYMN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine?
The IUPAC name of 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine (CID 16783784) is 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine.
What is the SMILES notation for 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine?
The canonical SMILES for 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine is CC(N)CCN1CC(C)OC(C)C1.
What is the InChIKey of 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine?
The InChIKey is KXDWRBIAWWLYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O/c1-8(11)4-5-12-6-9(2)13-10(3)7-12/h8-10H,4-7,11H2,1-3H3.
What are the key properties of 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine?
4-(2,6-dimethylmorpholin-4-yl)butan-2-amine has a molecular weight of 186.30 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dimethylmorpholin-4-yl)butan-2-amine is sourced from PubChem (CID 16783784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).