About N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine
N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine (PubChem CID 167838238) has the molecular formula C10H11F2N3S
and a molecular weight of 243.28 g/mol. Its IUPAC name is N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine.
Molecular Properties
| Compound Name | N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine |
| PubChem CID | 167838238 |
| Molecular Formula | C10H11F2N3S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine |
| SMILES | FC(F)c1nc(CNCc2cc[nH]c2)cs1 |
| InChI | InChI=1S/C10H11F2N3S/c11-9(12)10-15-8(6-16-10)5-14-4-7-1-2-13-3-7/h1-3,6,9,13-14H,4-5H2 |
| InChIKey | PDMMEYPCGIUKIF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine?
The IUPAC name of N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine (CID 167838238) is N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine.
What is the SMILES notation for N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine?
The canonical SMILES for N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine is FC(F)c1nc(CNCc2cc[nH]c2)cs1.
What is the InChIKey of N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine?
The InChIKey is PDMMEYPCGIUKIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2N3S/c11-9(12)10-15-8(6-16-10)5-14-4-7-1-2-13-3-7/h1-3,6,9,13-14H,4-5H2.
What are the key properties of N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine?
N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine has a molecular weight of 243.28 g/mol, XLogP of 2.70, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(difluoromethyl)-1,3-thiazol-4-yl]methyl]-1-(1H-pyrrol-3-yl)methanamine is sourced from PubChem (CID 167838238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).