C15H16F3N3 — CID 167838263
5-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine (PubChem CID 167838263) has the molecular formula C15H16F3N3 and a molecular weight of 295.31 g/mol. Its IUPAC name is 5-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine.
| Compound Name | 5-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 167838263 |
| Molecular Formula | C15H16F3N3 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 5-[[4-(2,2,2-trifluoroethyl)phenyl]methyl]-1,4,6,7-tetrahydropyrazolo[4,5-c]pyridine |
| SMILES | FC(F)(F)Cc1ccc(CN2CCc3[nH]ncc3C2)cc1 |
| InChI | InChI=1S/C15H16F3N3/c16-15(17,18)7-11-1-3-12(4-2-11)9-21-6-5-14-13(10-21)8-19-20-14/h1-4,8H,5-7,9-10H2,(H,19,20) |
| InChIKey | XFVOLFLVXQKUBG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |