About 2-(3-aminopropyl)-1H-pyridazine-3,6-dione
2-(3-aminopropyl)-1H-pyridazine-3,6-dione (PubChem CID 16783899) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-(3-aminopropyl)-1H-pyridazine-3,6-dione.
Molecular Properties
| Compound Name | 2-(3-aminopropyl)-1H-pyridazine-3,6-dione |
| PubChem CID | 16783899 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-(3-aminopropyl)-1H-pyridazine-3,6-dione |
| SMILES | NCCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C7H11N3O2/c8-4-1-5-10-7(12)3-2-6(11)9-10/h2-3H,1,4-5,8H2,(H,9,11) |
| InChIKey | UBEWJDRLIPBDOX-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-aminopropyl)-1H-pyridazine-3,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-aminopropyl)-1H-pyridazine-3,6-dione?
The IUPAC name of 2-(3-aminopropyl)-1H-pyridazine-3,6-dione (CID 16783899) is 2-(3-aminopropyl)-1H-pyridazine-3,6-dione.
What is the SMILES notation for 2-(3-aminopropyl)-1H-pyridazine-3,6-dione?
The canonical SMILES for 2-(3-aminopropyl)-1H-pyridazine-3,6-dione is NCCCn1[nH]c(=O)ccc1=O.
What is the InChIKey of 2-(3-aminopropyl)-1H-pyridazine-3,6-dione?
The InChIKey is UBEWJDRLIPBDOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c8-4-1-5-10-7(12)3-2-6(11)9-10/h2-3H,1,4-5,8H2,(H,9,11).
What are the key properties of 2-(3-aminopropyl)-1H-pyridazine-3,6-dione?
2-(3-aminopropyl)-1H-pyridazine-3,6-dione has a molecular weight of 169.18 g/mol, XLogP of -1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-aminopropyl)-1H-pyridazine-3,6-dione is sourced from PubChem (CID 16783899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).