C21H29ClN2O3 — CID 167839021
2-chloro-N-[2-[1-(3,4-dihydro-1H-isochromene-3-carbonyl)piperidin-4-yl]-2-methylpropyl]acetamide (PubChem CID 167839021) has the molecular formula C21H29ClN2O3 and a molecular weight of 392.93 g/mol. Its IUPAC name is 2-chloro-N-[2-[1-(3,4-dihydro-1H-isochromene-3-carbonyl)piperidin-4-yl]-2-methylpropyl]acetamide.
| Compound Name | 2-chloro-N-[2-[1-(3,4-dihydro-1H-isochromene-3-carbonyl)piperidin-4-yl]-2-methylpropyl]acetamide |
|---|---|
| PubChem CID | 167839021 |
| Molecular Formula | C21H29ClN2O3 |
| Molecular Weight | 392.93 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-chloro-N-[2-[1-(3,4-dihydro-1H-isochromene-3-carbonyl)piperidin-4-yl]-2-methylpropyl]acetamide |
| SMILES | CC(C)(CNC(=O)CCl)C1CCN(C(=O)C2Cc3ccccc3CO2)CC1 |
| InChI | InChI=1S/C21H29ClN2O3/c1-21(2,14-23-19(25)12-22)17-7-9-24(10-8-17)20(26)18-11-15-5-3-4-6-16(15)13-27-18/h3-6,17-18H,7-14H2,1-2H3,(H,23,25) |
| InChIKey | KNJDGSVANFVMJY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.93 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|