C19H27N5OS — CID 167839569
4-[[4-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine (PubChem CID 167839569) has the molecular formula C19H27N5OS and a molecular weight of 373.53 g/mol. Its IUPAC name is 4-[[4-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine.
| Compound Name | 4-[[4-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 167839569 |
| Molecular Formula | C19H27N5OS |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 4-[[4-[(3aR,6aR)-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl]-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl]methyl]morpholine |
| SMILES | Cc1sc2nc(CN3CCOCC3)nc(N3CC[C@@H]4CNC[C@@H]43)c2c1C |
| InChI | InChI=1S/C19H27N5OS/c1-12-13(2)26-19-17(12)18(24-4-3-14-9-20-10-15(14)24)21-16(22-19)11-23-5-7-25-8-6-23/h14-15,20H,3-11H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | ZPGPZFYETRZJSN-CABCVRRESA-N |
| XLogP | 1.94 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |