C24H42N6O2 — CID 167840023
2-(azocan-1-yl)-N-[4-[bis[2-(dimethylamino)ethyl]carbamoylamino]phenyl]acetamide (PubChem CID 167840023) has the molecular formula C24H42N6O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-(azocan-1-yl)-N-[4-[bis[2-(dimethylamino)ethyl]carbamoylamino]phenyl]acetamide.
| Compound Name | 2-(azocan-1-yl)-N-[4-[bis[2-(dimethylamino)ethyl]carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 167840023 |
| Molecular Formula | C24H42N6O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 2-(azocan-1-yl)-N-[4-[bis[2-(dimethylamino)ethyl]carbamoylamino]phenyl]acetamide |
| SMILES | CN(C)CCN(CCN(C)C)C(=O)Nc1ccc(NC(=O)CN2CCCCCCC2)cc1 |
| InChI | InChI=1S/C24H42N6O2/c1-27(2)16-18-30(19-17-28(3)4)24(32)26-22-12-10-21(11-13-22)25-23(31)20-29-14-8-6-5-7-9-15-29/h10-13H,5-9,14-20H2,1-4H3,(H,25,31)(H,26,32) |
| InChIKey | PDFIKFBCPJOHEN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |