C19H24ClN3O — CID 167840710
2-chloro-N-[(1S,2R)-1-methyl-2,3-dihydro-1H-inden-2-yl]-N-[(1-propan-2-ylpyrazol-4-yl)methyl]acetamide (PubChem CID 167840710) has the molecular formula C19H24ClN3O and a molecular weight of 345.87 g/mol. Its IUPAC name is 2-chloro-N-[(1S,2R)-1-methyl-2,3-dihydro-1H-inden-2-yl]-N-[(1-propan-2-ylpyrazol-4-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(1S,2R)-1-methyl-2,3-dihydro-1H-inden-2-yl]-N-[(1-propan-2-ylpyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 167840710 |
| Molecular Formula | C19H24ClN3O |
| Molecular Weight | 345.87 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 2-chloro-N-[(1S,2R)-1-methyl-2,3-dihydro-1H-inden-2-yl]-N-[(1-propan-2-ylpyrazol-4-yl)methyl]acetamide |
| SMILES | CC(C)n1cc(CN(C(=O)CCl)[C@@H]2Cc3ccccc3[C@@H]2C)cn1 |
| InChI | InChI=1S/C19H24ClN3O/c1-13(2)23-12-15(10-21-23)11-22(19(24)9-20)18-8-16-6-4-5-7-17(16)14(18)3/h4-7,10,12-14,18H,8-9,11H2,1-3H3/t14-,18+/m0/s1 |
| InChIKey | VWNCXIYIAYSMMK-KBXCAEBGSA-N |
| XLogP | 3.76 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|