C18H18O4 — CID 167840837
3-[4-[3-(2-methoxy-2-oxoethyl)phenyl]phenyl]propanoic acid (PubChem CID 167840837) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-[4-[3-(2-methoxy-2-oxoethyl)phenyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[3-(2-methoxy-2-oxoethyl)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 167840837 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-[4-[3-(2-methoxy-2-oxoethyl)phenyl]phenyl]propanoic acid |
| SMILES | COC(=O)Cc1cccc(-c2ccc(CCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C18H18O4/c1-22-18(21)12-14-3-2-4-16(11-14)15-8-5-13(6-9-15)7-10-17(19)20/h2-6,8-9,11H,7,10,12H2,1H3,(H,19,20) |
| InChIKey | FKWFYXZQCSEKAC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |