C16H22N4O3S — CID 167841643
(3aR,4R,7S,7aS)-N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide (PubChem CID 167841643) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide.
| Compound Name | (3aR,4R,7S,7aS)-N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
|---|---|
| PubChem CID | 167841643 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (3aR,4R,7S,7aS)-N-[5-(oxan-4-yl)-1,3,4-thiadiazol-2-yl]-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-2-carboxamide |
| SMILES | O=C(Nc1nnc(C2CCOCC2)s1)N1C[C@@H]2[C@H](C1)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C16H22N4O3S/c21-16(20-7-10-11(8-20)13-2-1-12(10)23-13)17-15-19-18-14(24-15)9-3-5-22-6-4-9/h9-13H,1-8H2,(H,17,19,21)/t10-,11+,12+,13- |
| InChIKey | KAUCIVHMAQFPRT-FNFFVJSTSA-N |
| XLogP | 2.07 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |