C17H18N6O2 — CID 167842497
3-[4-(2-methoxyphenyl)triazol-1-yl]-1-(1-methylpyrazol-3-yl)pyrrolidin-2-one (PubChem CID 167842497) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 3-[4-(2-methoxyphenyl)triazol-1-yl]-1-(1-methylpyrazol-3-yl)pyrrolidin-2-one.
| Compound Name | 3-[4-(2-methoxyphenyl)triazol-1-yl]-1-(1-methylpyrazol-3-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 167842497 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 3-[4-(2-methoxyphenyl)triazol-1-yl]-1-(1-methylpyrazol-3-yl)pyrrolidin-2-one |
| SMILES | COc1ccccc1-c1cn(C2CCN(c3ccn(C)n3)C2=O)nn1 |
| InChI | InChI=1S/C17H18N6O2/c1-21-9-8-16(19-21)22-10-7-14(17(22)24)23-11-13(18-20-23)12-5-3-4-6-15(12)25-2/h3-6,8-9,11,14H,7,10H2,1-2H3 |
| InChIKey | BXMLZYCKTOXTLB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 78.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |