C25H29N3O5S — CID 167844134
(11E)-9,16-dimethyl-8,8-dioxo-15-oxa-8λ6-thia-1,9,18-triazatetracyclo[17.7.1.13,7.020,25]octacosa-3(28),4,6,11,20,22,24-heptaene-2,17-dione (PubChem CID 167844134) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is (11E)-9,16-dimethyl-8,8-dioxo-15-oxa-8λ6-thia-1,9,18-triazatetracyclo[17.7.1.13,7.020,25]octacosa-3(28),4,6,11,20,22,24-heptaene-2,17-dione.
| Compound Name | (11E)-9,16-dimethyl-8,8-dioxo-15-oxa-8λ6-thia-1,9,18-triazatetracyclo[17.7.1.13,7.020,25]octacosa-3(28),4,6,11,20,22,24-heptaene-2,17-dione |
|---|---|
| PubChem CID | 167844134 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | (11E)-9,16-dimethyl-8,8-dioxo-15-oxa-8λ6-thia-1,9,18-triazatetracyclo[17.7.1.13,7.020,25]octacosa-3(28),4,6,11,20,22,24-heptaene-2,17-dione |
| SMILES | CC1OCC/C=C/CN(C)S(=O)(=O)c2cccc(c2)C(=O)N2Cc3ccccc3C(C2)NC1=O |
| InChI | InChI=1S/C25H29N3O5S/c1-18-24(29)26-23-17-28(16-20-9-4-5-12-22(20)23)25(30)19-10-8-11-21(15-19)34(31,32)27(2)13-6-3-7-14-33-18/h3-6,8-12,15,18,23H,7,13-14,16-17H2,1-2H3,(H,26,29)/b6-3+ |
| InChIKey | QZEQTAQUASNECN-ZZXKWVIFSA-N |
| XLogP | 2.49 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|