About 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole
4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole (PubChem CID 167844309) has the molecular formula C13H11BrF3N3
and a molecular weight of 346.15 g/mol. Its IUPAC name is 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole.
Molecular Properties
| Compound Name | 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole |
| PubChem CID | 167844309 |
| Molecular Formula | C13H11BrF3N3 |
| Molecular Weight | 346.15 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole |
| SMILES | C[C@@H]1[C@@H](Cn2cc(-c3ccc(F)c(Br)c3)nn2)C1(F)F |
| InChI | InChI=1S/C13H11BrF3N3/c1-7-9(13(7,16)17)5-20-6-12(18-19-20)8-2-3-11(15)10(14)4-8/h2-4,6-7,9H,5H2,1H3/t7-,9-/m1/s1 |
| InChIKey | VYPHCKZWADSTOO-VXNVDRBHSA-N |
| XLogP | 3.75 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.15 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole?
The IUPAC name of 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole (CID 167844309) is 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole.
What is the SMILES notation for 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole?
The canonical SMILES for 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole is C[C@@H]1[C@@H](Cn2cc(-c3ccc(F)c(Br)c3)nn2)C1(F)F.
What is the InChIKey of 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole?
The InChIKey is VYPHCKZWADSTOO-VXNVDRBHSA-N. The full InChI is InChI=1S/C13H11BrF3N3/c1-7-9(13(7,16)17)5-20-6-12(18-19-20)8-2-3-11(15)10(14)4-8/h2-4,6-7,9H,5H2,1H3/t7-,9-/m1/s1.
What are the key properties of 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole?
4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole has a molecular weight of 346.15 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-bromo-4-fluorophenyl)-1-[[(1S,3R)-2,2-difluoro-3-methylcyclopropyl]methyl]triazole is sourced from PubChem (CID 167844309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).