About (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate
(1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate (PubChem CID 167844325) has the molecular formula C14H17FN2O3
and a molecular weight of 280.30 g/mol. Its IUPAC name is (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate.
Molecular Properties
| Compound Name | (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate |
| PubChem CID | 167844325 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate |
| SMILES | CCN1CC(OC(=O)c2ccc(C)cc2F)CNC1=O |
| InChI | InChI=1S/C14H17FN2O3/c1-3-17-8-10(7-16-14(17)19)20-13(18)11-5-4-9(2)6-12(11)15/h4-6,10H,3,7-8H2,1-2H3,(H,16,19) |
| InChIKey | QVKBUEPBRZZFDN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate?
The IUPAC name of (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate (CID 167844325) is (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate.
What is the SMILES notation for (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate?
The canonical SMILES for (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate is CCN1CC(OC(=O)c2ccc(C)cc2F)CNC1=O.
What is the InChIKey of (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate?
The InChIKey is QVKBUEPBRZZFDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN2O3/c1-3-17-8-10(7-16-14(17)19)20-13(18)11-5-4-9(2)6-12(11)15/h4-6,10H,3,7-8H2,1-2H3,(H,16,19).
What are the key properties of (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate?
(1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate has a molecular weight of 280.30 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethyl-2-oxo-1,3-diazinan-5-yl) 2-fluoro-4-methylbenzoate is sourced from PubChem (CID 167844325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).