C14H15F3N4O5S2 — CID 167844359
3-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 167844359) has the molecular formula C14H15F3N4O5S2 and a molecular weight of 440.43 g/mol. Its IUPAC name is 3-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167844359 |
| Molecular Formula | C14H15F3N4O5S2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 3-[2-(pyrazolo[1,5-a]pyrimidine-6-carbonylamino)ethyldisulfanyl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCSSCCNC(=O)c1cnc2ccnn2c1 |
| InChI | InChI=1S/C12H14N4O3S2.C2HF3O2/c17-11(18)2-5-20-21-6-4-13-12(19)9-7-14-10-1-3-15-16(10)8-9;3-2(4,5)1(6)7/h1,3,7-8H,2,4-6H2,(H,13,19)(H,17,18);(H,6,7) |
| InChIKey | FBQVPFUXKJZPPB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|