About 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide
6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide (PubChem CID 16784441) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide.
Molecular Properties
| Compound Name | 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
| PubChem CID | 16784441 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide |
| SMILES | NC(=O)N1CCc2sccc2C1 |
| InChI | InChI=1S/C8H10N2OS/c9-8(11)10-3-1-7-6(5-10)2-4-12-7/h2,4H,1,3,5H2,(H2,9,11) |
| InChIKey | NQPIVSJKPXGRJT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide?
The IUPAC name of 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide (CID 16784441) is 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide.
What is the SMILES notation for 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide?
The canonical SMILES for 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide is NC(=O)N1CCc2sccc2C1.
What is the InChIKey of 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide?
The InChIKey is NQPIVSJKPXGRJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c9-8(11)10-3-1-7-6(5-10)2-4-12-7/h2,4H,1,3,5H2,(H2,9,11).
What are the key properties of 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide?
6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide has a molecular weight of 182.25 g/mol, XLogP of 1.18, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-4H-thieno[3,2-c]pyridine-5-carboxamide is sourced from PubChem (CID 16784441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).