C22H26N6O3S — CID 167844441
N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide (PubChem CID 167844441) has the molecular formula C22H26N6O3S and a molecular weight of 454.56 g/mol. Its IUPAC name is N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide.
| Compound Name | N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide |
|---|---|
| PubChem CID | 167844441 |
| Molecular Formula | C22H26N6O3S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[4-(1-adamantyl)-1,3-thiazol-2-yl]-3-(3-methyl-2,6-dioxo-7H-purin-8-yl)propanamide |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(CCC(=O)Nc3nc(C45CC6CC(CC(C6)C4)C5)cs3)nc21 |
| InChI | InChI=1S/C22H26N6O3S/c1-28-18-17(19(30)27-21(28)31)24-15(25-18)2-3-16(29)26-20-23-14(10-32-20)22-7-11-4-12(8-22)6-13(5-11)9-22/h10-13H,2-9H2,1H3,(H,24,25)(H,23,26,29)(H,27,30,31) |
| InChIKey | ONXHZAOVBKVQDP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 125.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |