C19H27N3O3 — CID 167844457
3-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-(pyridin-4-ylmethyl)amino]propanoic acid (PubChem CID 167844457) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 3-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-(pyridin-4-ylmethyl)amino]propanoic acid.
| Compound Name | 3-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-(pyridin-4-ylmethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 167844457 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-[[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl]-(pyridin-4-ylmethyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(Cc1ccncc1)C(=O)N1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C19H27N3O3/c23-18(24)9-13-21(14-15-7-10-20-11-8-15)19(25)22-12-3-5-16-4-1-2-6-17(16)22/h7-8,10-11,16-17H,1-6,9,12-14H2,(H,23,24)/t16-,17-/m0/s1 |
| InChIKey | DNTYQLSKYWEBDB-IRXDYDNUSA-N |
| XLogP | 3.13 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |