C18H22N2O3 — CID 167844599
4-[3-(2-piperidin-1-ylethoxy)phenyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 167844599) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-[3-(2-piperidin-1-ylethoxy)phenyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[3-(2-piperidin-1-ylethoxy)phenyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 167844599 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-[3-(2-piperidin-1-ylethoxy)phenyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccc(OCCN3CCCCC3)c2)c[nH]1 |
| InChI | InChI=1S/C18H22N2O3/c21-18(22)17-12-15(13-19-17)14-5-4-6-16(11-14)23-10-9-20-7-2-1-3-8-20/h4-6,11-13,19H,1-3,7-10H2,(H,21,22) |
| InChIKey | LZOXQKANYXAIOU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |