About 4-N,4-N-dimethylbenzene-1,4-disulfonamide
4-N,4-N-dimethylbenzene-1,4-disulfonamide (PubChem CID 16784503) has the molecular formula C8H12N2O4S2
and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-N,4-N-dimethylbenzene-1,4-disulfonamide.
Molecular Properties
| Compound Name | 4-N,4-N-dimethylbenzene-1,4-disulfonamide |
| PubChem CID | 16784503 |
| Molecular Formula | C8H12N2O4S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 4-N,4-N-dimethylbenzene-1,4-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C8H12N2O4S2/c1-10(2)16(13,14)8-5-3-7(4-6-8)15(9,11)12/h3-6H,1-2H3,(H2,9,11,12) |
| InChIKey | YQVXYYCWEPCDTF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N,4-N-dimethylbenzene-1,4-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dimethylbenzene-1,4-disulfonamide?
The IUPAC name of 4-N,4-N-dimethylbenzene-1,4-disulfonamide (CID 16784503) is 4-N,4-N-dimethylbenzene-1,4-disulfonamide.
What is the SMILES notation for 4-N,4-N-dimethylbenzene-1,4-disulfonamide?
The canonical SMILES for 4-N,4-N-dimethylbenzene-1,4-disulfonamide is CN(C)S(=O)(=O)c1ccc(S(N)(=O)=O)cc1.
What is the InChIKey of 4-N,4-N-dimethylbenzene-1,4-disulfonamide?
The InChIKey is YQVXYYCWEPCDTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4S2/c1-10(2)16(13,14)8-5-3-7(4-6-8)15(9,11)12/h3-6H,1-2H3,(H2,9,11,12).
What are the key properties of 4-N,4-N-dimethylbenzene-1,4-disulfonamide?
4-N,4-N-dimethylbenzene-1,4-disulfonamide has a molecular weight of 264.33 g/mol, XLogP of -0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dimethylbenzene-1,4-disulfonamide is sourced from PubChem (CID 16784503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).