About potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate
potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate (PubChem CID 167845912) has the molecular formula C11H14KNO4S
and a molecular weight of 295.40 g/mol. Its IUPAC name is potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate |
| PubChem CID | 167845912 |
| Molecular Formula | C11H14KNO4S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate |
| SMILES | CO[C@@H]1CN(C(C(=O)[O-])c2ccsc2)C[C@H]1O.[K+] |
| InChI | InChI=1S/C11H15NO4S.K/c1-16-9-5-12(4-8(9)13)10(11(14)15)7-2-3-17-6-7;/h2-3,6,8-10,13H,4-5H2,1H3,(H,14,15);/q;+1/p-1/t8-,9-,10?;/m1./s1 |
| InChIKey | CMPMCNGCKVFCGE-FBFVXXOASA-M |
| XLogP | -3.77 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate?
The IUPAC name of potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate (CID 167845912) is potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate.
What is the SMILES notation for potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate?
The canonical SMILES for potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate is CO[C@@H]1CN(C(C(=O)[O-])c2ccsc2)C[C@H]1O.[K+].
What is the InChIKey of potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate?
The InChIKey is CMPMCNGCKVFCGE-FBFVXXOASA-M. The full InChI is InChI=1S/C11H15NO4S.K/c1-16-9-5-12(4-8(9)13)10(11(14)15)7-2-3-17-6-7;/h2-3,6,8-10,13H,4-5H2,1H3,(H,14,15);/q;+1/p-1/t8-,9-,10?;/m1./s1.
What are the key properties of potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate?
potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate has a molecular weight of 295.40 g/mol, XLogP of -3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2-[(3R,4R)-3-hydroxy-4-methoxypyrrolidin-1-yl]-2-thiophen-3-ylacetate is sourced from PubChem (CID 167845912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).