About 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate
1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate (PubChem CID 167845938) has the molecular formula C23H19FN2O4S
and a molecular weight of 438.48 g/mol. Its IUPAC name is 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate.
Molecular Properties
| Compound Name | 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate |
| PubChem CID | 167845938 |
| Molecular Formula | C23H19FN2O4S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate |
| SMILES | O=C(OCc1cccc2[nH]ccc12)c1cccc(CNS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H19FN2O4S/c24-19-7-9-20(10-8-19)31(28,29)26-14-16-3-1-4-17(13-16)23(27)30-15-18-5-2-6-22-21(18)11-12-25-22/h1-13,25-26H,14-15H2 |
| InChIKey | QNTFFOMZDDKOBH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate?
The IUPAC name of 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate (CID 167845938) is 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate.
What is the SMILES notation for 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate?
The canonical SMILES for 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate is O=C(OCc1cccc2[nH]ccc12)c1cccc(CNS(=O)(=O)c2ccc(F)cc2)c1.
What is the InChIKey of 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate?
The InChIKey is QNTFFOMZDDKOBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19FN2O4S/c24-19-7-9-20(10-8-19)31(28,29)26-14-16-3-1-4-17(13-16)23(27)30-15-18-5-2-6-22-21(18)11-12-25-22/h1-13,25-26H,14-15H2.
What are the key properties of 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate?
1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate has a molecular weight of 438.48 g/mol, XLogP of 4.14, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-4-ylmethyl 3-[[(4-fluorophenyl)sulfonylamino]methyl]benzoate is sourced from PubChem (CID 167845938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).