C21H21ClN2O — CID 167845992
N-[(2-chloro-6-methoxyphenyl)methyl]-1-(4-pyridin-4-ylphenyl)ethanamine (PubChem CID 167845992) has the molecular formula C21H21ClN2O and a molecular weight of 352.87 g/mol. Its IUPAC name is N-[(2-chloro-6-methoxyphenyl)methyl]-1-(4-pyridin-4-ylphenyl)ethanamine.
| Compound Name | N-[(2-chloro-6-methoxyphenyl)methyl]-1-(4-pyridin-4-ylphenyl)ethanamine |
|---|---|
| PubChem CID | 167845992 |
| Molecular Formula | C21H21ClN2O |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[(2-chloro-6-methoxyphenyl)methyl]-1-(4-pyridin-4-ylphenyl)ethanamine |
| SMILES | COc1cccc(Cl)c1CNC(C)c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/C21H21ClN2O/c1-15(24-14-19-20(22)4-3-5-21(19)25-2)16-6-8-17(9-7-16)18-10-12-23-13-11-18/h3-13,15,24H,14H2,1-2H3 |
| InChIKey | SPLYLCRXNRNQHN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |