C16H16FN3O — CID 167846322
5-fluoro-2-(4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-ylmethyl)phenol (PubChem CID 167846322) has the molecular formula C16H16FN3O and a molecular weight of 285.32 g/mol. Its IUPAC name is 5-fluoro-2-(4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-ylmethyl)phenol.
| Compound Name | 5-fluoro-2-(4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-ylmethyl)phenol |
|---|---|
| PubChem CID | 167846322 |
| Molecular Formula | C16H16FN3O |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 5-fluoro-2-(4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-ylmethyl)phenol |
| SMILES | Oc1cc(F)ccc1CN1C2CCC1c1cncnc1C2 |
| InChI | InChI=1S/C16H16FN3O/c17-11-2-1-10(16(21)5-11)8-20-12-3-4-15(20)13-7-18-9-19-14(13)6-12/h1-2,5,7,9,12,15,21H,3-4,6,8H2 |
| InChIKey | XSQGWHRGMUUWDA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|