C17H17N5O2 — CID 167847486
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide (PubChem CID 167847486) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 167847486 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide |
| SMILES | C#CCCC1(CCNC(=O)c2ccccc2-c2nc(C)no2)N=N1 |
| InChI | InChI=1S/C17H17N5O2/c1-3-4-9-17(21-22-17)10-11-18-15(23)13-7-5-6-8-14(13)16-19-12(2)20-24-16/h1,5-8H,4,9-11H2,2H3,(H,18,23) |
| InChIKey | LMWUGQPWUFLROO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|