About 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one
3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one (PubChem CID 167849092) has the molecular formula C22H25N5O4
and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one.
Molecular Properties
| Compound Name | 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one |
| PubChem CID | 167849092 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one |
| SMILES | O=C1CN(CC(O)C(O)C(O)c2cnn(-c3ccccc3)n2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H25N5O4/c28-19(13-25-14-20(29)26(15-25)12-16-7-3-1-4-8-16)22(31)21(30)18-11-23-27(24-18)17-9-5-2-6-10-17/h1-11,19,21-22,28,30-31H,12-15H2 |
| InChIKey | TWKRNBBOUDPARJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one?
The IUPAC name of 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one (CID 167849092) is 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one.
What is the SMILES notation for 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one?
The canonical SMILES for 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one is O=C1CN(CC(O)C(O)C(O)c2cnn(-c3ccccc3)n2)CN1Cc1ccccc1.
What is the InChIKey of 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one?
The InChIKey is TWKRNBBOUDPARJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N5O4/c28-19(13-25-14-20(29)26(15-25)12-16-7-3-1-4-8-16)22(31)21(30)18-11-23-27(24-18)17-9-5-2-6-10-17/h1-11,19,21-22,28,30-31H,12-15H2.
What are the key properties of 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one?
3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one has a molecular weight of 423.47 g/mol, XLogP of 0.32, 8 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1-[2,3,4-trihydroxy-4-(2-phenyltriazol-4-yl)butyl]imidazolidin-4-one is sourced from PubChem (CID 167849092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).