C21H28F3N5O4S — CID 167849250
1-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea;2,2,2-trifluoroacetic acid (PubChem CID 167849250) has the molecular formula C21H28F3N5O4S and a molecular weight of 503.55 g/mol. Its IUPAC name is 1-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167849250 |
| Molecular Formula | C21H28F3N5O4S |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | 1-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-(2,2,6,6-tetramethylpiperidin-4-yl)urea;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(-c2nnc(NC(=O)NC3CC(C)(C)NC(C)(C)C3)s2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H27N5O2S.C2HF3O2/c1-18(2)10-13(11-19(3,4)24-18)20-16(25)21-17-23-22-15(27-17)12-6-8-14(26-5)9-7-12;3-2(4,5)1(6)7/h6-9,13,24H,10-11H2,1-5H3,(H2,20,21,23,25);(H,6,7) |
| InChIKey | RLKIPSSZKRYJCY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |