C13H12N2S — CID 16784974
2-amino-4-(2,4-dimethylphenyl)thiophene-3-carbonitrile (PubChem CID 16784974) has the molecular formula C13H12N2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-amino-4-(2,4-dimethylphenyl)thiophene-3-carbonitrile.
| Compound Name | 2-amino-4-(2,4-dimethylphenyl)thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 16784974 |
| Molecular Formula | C13H12N2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-amino-4-(2,4-dimethylphenyl)thiophene-3-carbonitrile |
| SMILES | Cc1ccc(-c2csc(N)c2C#N)c(C)c1 |
| InChI | InChI=1S/C13H12N2S/c1-8-3-4-10(9(2)5-8)12-7-16-13(15)11(12)6-14/h3-5,7H,15H2,1-2H3 |
| InChIKey | DFGLGYIFILCDSN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |