C14H23N5O — CID 167849942
(7R,8aS)-2-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 167849942) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is (7R,8aS)-2-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (7R,8aS)-2-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 167849942 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (7R,8aS)-2-[[2-(dimethylamino)pyrimidin-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | CN(C)c1ncc(CN2CCN3C[C@H](O)C[C@H]3C2)cn1 |
| InChI | InChI=1S/C14H23N5O/c1-17(2)14-15-6-11(7-16-14)8-18-3-4-19-10-13(20)5-12(19)9-18/h6-7,12-13,20H,3-5,8-10H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | WFFTUFFRJRBXGX-QWHCGFSZSA-N |
| XLogP | -0.21 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |