C19H21N3O4 — CID 167849998
2-[3-oxo-3-(10-oxo-3,9-diazabicyclo[3.3.2]decan-3-yl)propyl]isoindole-1,3-dione (PubChem CID 167849998) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[3-oxo-3-(10-oxo-3,9-diazabicyclo[3.3.2]decan-3-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-oxo-3-(10-oxo-3,9-diazabicyclo[3.3.2]decan-3-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167849998 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[3-oxo-3-(10-oxo-3,9-diazabicyclo[3.3.2]decan-3-yl)propyl]isoindole-1,3-dione |
| SMILES | O=C1NC2CCCC1CN(C(=O)CCN1C(=O)c3ccccc3C1=O)C2 |
| InChI | InChI=1S/C19H21N3O4/c23-16(21-10-12-4-3-5-13(11-21)20-17(12)24)8-9-22-18(25)14-6-1-2-7-15(14)19(22)26/h1-2,6-7,12-13H,3-5,8-11H2,(H,20,24) |
| InChIKey | FCXWCKCGVQMEBJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|