About 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine
4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine (PubChem CID 16785010) has the molecular formula C10H8N4S
and a molecular weight of 216.27 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine.
Molecular Properties
| Compound Name | 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine |
| PubChem CID | 16785010 |
| Molecular Formula | C10H8N4S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine |
| SMILES | Nc1[nH]ncc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C10H8N4S/c11-9-6(5-12-14-9)10-13-7-3-1-2-4-8(7)15-10/h1-5H,(H3,11,12,14) |
| InChIKey | WJYXQGODMGVTKA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrazole_amino_B(1)', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine?
The IUPAC name of 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine (CID 16785010) is 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine.
What is the SMILES notation for 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine?
The canonical SMILES for 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine is Nc1[nH]ncc1-c1nc2ccccc2s1.
What is the InChIKey of 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine?
The InChIKey is WJYXQGODMGVTKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4S/c11-9-6(5-12-14-9)10-13-7-3-1-2-4-8(7)15-10/h1-5H,(H3,11,12,14).
What are the key properties of 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine?
4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine has a molecular weight of 216.27 g/mol, XLogP of 2.27, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzothiazol-2-yl)-1H-pyrazol-5-amine is sourced from PubChem (CID 16785010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).