About N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine
N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine (PubChem CID 16785048) has the molecular formula C10H18N2S
and a molecular weight of 198.34 g/mol. Its IUPAC name is N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine |
| PubChem CID | 16785048 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.34 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine |
| SMILES | CCN(CC)C(CN)c1ccsc1 |
| InChI | InChI=1S/C10H18N2S/c1-3-12(4-2)10(7-11)9-5-6-13-8-9/h5-6,8,10H,3-4,7,11H2,1-2H3 |
| InChIKey | LMACEHBBGMXZMU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine?
The IUPAC name of N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine (CID 16785048) is N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine.
What is the SMILES notation for N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine?
The canonical SMILES for N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine is CCN(CC)C(CN)c1ccsc1.
What is the InChIKey of N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine?
The InChIKey is LMACEHBBGMXZMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2S/c1-3-12(4-2)10(7-11)9-5-6-13-8-9/h5-6,8,10H,3-4,7,11H2,1-2H3.
What are the key properties of N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine?
N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine has a molecular weight of 198.34 g/mol, XLogP of 2.09, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-1-thiophen-3-ylethane-1,2-diamine is sourced from PubChem (CID 16785048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).