About 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole
4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole (PubChem CID 167851772) has the molecular formula C16H11N3O
and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole |
| PubChem CID | 167851772 |
| Molecular Formula | C16H11N3O |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole |
| SMILES | c1ccc(-c2ncoc2-c2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C16H11N3O/c1-2-4-11(5-3-1)14-15(20-10-19-14)12-6-8-17-16-13(12)7-9-18-16/h1-10H,(H,17,18) |
| InChIKey | CGDWHZTVMKCRTO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole?
The IUPAC name of 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole (CID 167851772) is 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole.
What is the SMILES notation for 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole?
The canonical SMILES for 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole is c1ccc(-c2ncoc2-c2ccnc3[nH]ccc23)cc1.
What is the InChIKey of 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole?
The InChIKey is CGDWHZTVMKCRTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O/c1-2-4-11(5-3-1)14-15(20-10-19-14)12-6-8-17-16-13(12)7-9-18-16/h1-10H,(H,17,18).
What are the key properties of 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole?
4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole has a molecular weight of 261.28 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)-1,3-oxazole is sourced from PubChem (CID 167851772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).