C24H28F5N5O3 — CID 167852329
9-[[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]amino]-1,4-diazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid (PubChem CID 167852329) has the molecular formula C24H28F5N5O3 and a molecular weight of 529.51 g/mol. Its IUPAC name is 9-[[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]amino]-1,4-diazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | 9-[[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]amino]-1,4-diazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167852329 |
| Molecular Formula | C24H28F5N5O3 |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 9-[[2-(2,4-difluorophenyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]amino]-1,4-diazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1NCCNC12CCC(NC1CCc3nc(-c4ccc(F)cc4F)cn3C1)CC2 |
| InChI | InChI=1S/C22H27F2N5O.C2HF3O2/c23-14-1-3-17(18(24)11-14)19-13-29-12-16(2-4-20(29)28-19)27-15-5-7-22(8-6-15)21(30)25-9-10-26-22;3-2(4,5)1(6)7/h1,3,11,13,15-16,26-27H,2,4-10,12H2,(H,25,30);(H,6,7) |
| InChIKey | WPNGOESQWCNLQV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |