C19H18F2N2O3 — CID 167852729
methyl 1-[3-[(4-amino-3,5-difluorobenzoyl)amino]phenyl]cyclobutane-1-carboxylate (PubChem CID 167852729) has the molecular formula C19H18F2N2O3 and a molecular weight of 360.36 g/mol. Its IUPAC name is methyl 1-[3-[(4-amino-3,5-difluorobenzoyl)amino]phenyl]cyclobutane-1-carboxylate.
| Compound Name | methyl 1-[3-[(4-amino-3,5-difluorobenzoyl)amino]phenyl]cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 167852729 |
| Molecular Formula | C19H18F2N2O3 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | methyl 1-[3-[(4-amino-3,5-difluorobenzoyl)amino]phenyl]cyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(c2cccc(NC(=O)c3cc(F)c(N)c(F)c3)c2)CCC1 |
| InChI | InChI=1S/C19H18F2N2O3/c1-26-18(25)19(6-3-7-19)12-4-2-5-13(10-12)23-17(24)11-8-14(20)16(22)15(21)9-11/h2,4-5,8-10H,3,6-7,22H2,1H3,(H,23,24) |
| InChIKey | HWUBMJHFYCGSIV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|