C15H13ClN6O — CID 167855187
5-[[1-(6-chloro-3-pyridinyl)ethylamino]methyl]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile (PubChem CID 167855187) has the molecular formula C15H13ClN6O and a molecular weight of 328.76 g/mol. Its IUPAC name is 5-[[1-(6-chloro-3-pyridinyl)ethylamino]methyl]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile.
| Compound Name | 5-[[1-(6-chloro-3-pyridinyl)ethylamino]methyl]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile |
|---|---|
| PubChem CID | 167855187 |
| Molecular Formula | C15H13ClN6O |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 5-[[1-(6-chloro-3-pyridinyl)ethylamino]methyl]-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile |
| SMILES | CC(NCc1cc(=O)n2[nH]cc(C#N)c2n1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H13ClN6O/c1-9(10-2-3-13(16)19-6-10)18-8-12-4-14(23)22-15(21-12)11(5-17)7-20-22/h2-4,6-7,9,18,20H,8H2,1H3 |
| InChIKey | FERQNCZCIBKJRT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 98.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|