C17H23F6N5O2 — CID 167856327
4-(azetidin-3-yl)-2-[(3S,5R)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrimidine;2,2,2-trifluoroacetic acid (PubChem CID 167856327) has the molecular formula C17H23F6N5O2 and a molecular weight of 443.39 g/mol. Its IUPAC name is 4-(azetidin-3-yl)-2-[(3S,5R)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrimidine;2,2,2-trifluoroacetic acid.
| Compound Name | 4-(azetidin-3-yl)-2-[(3S,5R)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrimidine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167856327 |
| Molecular Formula | C17H23F6N5O2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 4-(azetidin-3-yl)-2-[(3S,5R)-3,5-dimethyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrimidine;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@H]1CN(c2nccc(C3CNC3)n2)C[C@H](C)N1CC(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22F3N5.C2HF3O2/c1-10-7-22(8-11(2)23(10)9-15(16,17)18)14-20-4-3-13(21-14)12-5-19-6-12;3-2(4,5)1(6)7/h3-4,10-12,19H,5-9H2,1-2H3;(H,6,7)/t10-,11+; |
| InChIKey | PVFZLKVJGWSNET-NJJJQDLFSA-N |
| XLogP | 2.26 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |