C14H15F3N2O2 — CID 167856876
2-[1-[[2-methoxy-6-(trifluoromethoxy)anilino]methyl]cyclopropyl]acetonitrile (PubChem CID 167856876) has the molecular formula C14H15F3N2O2 and a molecular weight of 300.28 g/mol. Its IUPAC name is 2-[1-[[2-methoxy-6-(trifluoromethoxy)anilino]methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[[2-methoxy-6-(trifluoromethoxy)anilino]methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 167856876 |
| Molecular Formula | C14H15F3N2O2 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-[1-[[2-methoxy-6-(trifluoromethoxy)anilino]methyl]cyclopropyl]acetonitrile |
| SMILES | COc1cccc(OC(F)(F)F)c1NCC1(CC#N)CC1 |
| InChI | InChI=1S/C14H15F3N2O2/c1-20-10-3-2-4-11(21-14(15,16)17)12(10)19-9-13(5-6-13)7-8-18/h2-4,19H,5-7,9H2,1H3 |
| InChIKey | LPARKUNVCPSXET-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |