C27H29N3O3S — CID 167857062
4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 167857062) has the molecular formula C27H29N3O3S and a molecular weight of 475.61 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 167857062 |
| Molecular Formula | C27H29N3O3S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1S(=O)(=O)N1CCCCC1)c1ccc(N2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C27H29N3O3S/c31-27(28-25-10-4-5-11-26(25)34(32,33)30-17-6-1-7-18-30)22-12-14-24(15-13-22)29-19-16-21-8-2-3-9-23(21)20-29/h2-5,8-15H,1,6-7,16-20H2,(H,28,31) |
| InChIKey | UTPUUZIDOJQABY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |