About 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide
5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide (PubChem CID 167857778) has the molecular formula C10H13N3O5S2
and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide.
Molecular Properties
| Compound Name | 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide |
| PubChem CID | 167857778 |
| Molecular Formula | C10H13N3O5S2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCN2CCCS2(=O)=O)o1 |
| InChI | InChI=1S/C10H13N3O5S2/c11-8-9-2-3-10(18-9)20(16,17)12-4-6-13-5-1-7-19(13,14)15/h2-3,12H,1,4-7H2 |
| InChIKey | BAYWVULROJSJQZ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide?
The IUPAC name of 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide (CID 167857778) is 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide.
What is the SMILES notation for 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide?
The canonical SMILES for 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide is N#Cc1ccc(S(=O)(=O)NCCN2CCCS2(=O)=O)o1.
What is the InChIKey of 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide?
The InChIKey is BAYWVULROJSJQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O5S2/c11-8-9-2-3-10(18-9)20(16,17)12-4-6-13-5-1-7-19(13,14)15/h2-3,12H,1,4-7H2.
What are the key properties of 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide?
5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide has a molecular weight of 319.36 g/mol, XLogP of -0.53, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]furan-2-sulfonamide is sourced from PubChem (CID 167857778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).