C16H16N4O5 — CID 167858901
4-methyl-5-oxo-1-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]piperazine-2-carboxylic acid (PubChem CID 167858901) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is 4-methyl-5-oxo-1-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]piperazine-2-carboxylic acid.
| Compound Name | 4-methyl-5-oxo-1-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]piperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 167858901 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4-methyl-5-oxo-1-[2-(4-oxo-3H-phthalazin-1-yl)acetyl]piperazine-2-carboxylic acid |
| SMILES | CN1CC(C(=O)O)N(C(=O)Cc2n[nH]c(=O)c3ccccc23)CC1=O |
| InChI | InChI=1S/C16H16N4O5/c1-19-7-12(16(24)25)20(8-14(19)22)13(21)6-11-9-4-2-3-5-10(9)15(23)18-17-11/h2-5,12H,6-8H2,1H3,(H,18,23)(H,24,25) |
| InChIKey | KAQHQLTUMOHPPS-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |