About 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide
6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide (PubChem CID 167859798) has the molecular formula C15H12ClF2N3O2S
and a molecular weight of 371.80 g/mol. Its IUPAC name is 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide |
| PubChem CID | 167859798 |
| Molecular Formula | C15H12ClF2N3O2S |
| Molecular Weight | 371.80 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide |
| SMILES | O=S(=O)(NCC(F)(F)c1ccccn1)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H12ClF2N3O2S/c16-10-4-5-11-12(7-10)20-8-13(11)24(22,23)21-9-15(17,18)14-3-1-2-6-19-14/h1-8,20-21H,9H2 |
| InChIKey | UBYSSEGWCYPPBQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide?
The IUPAC name of 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide (CID 167859798) is 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide.
What is the SMILES notation for 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide?
The canonical SMILES for 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide is O=S(=O)(NCC(F)(F)c1ccccn1)c1c[nH]c2cc(Cl)ccc12.
What is the InChIKey of 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide?
The InChIKey is UBYSSEGWCYPPBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClF2N3O2S/c16-10-4-5-11-12(7-10)20-8-13(11)24(22,23)21-9-15(17,18)14-3-1-2-6-19-14/h1-8,20-21H,9H2.
What are the key properties of 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide?
6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide has a molecular weight of 371.80 g/mol, XLogP of 3.29, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(2,2-difluoro-2-pyridin-2-ylethyl)-1H-indole-3-sulfonamide is sourced from PubChem (CID 167859798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).