About 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one
7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one (PubChem CID 167859815) has the molecular formula C18H13FN2O2
and a molecular weight of 308.31 g/mol. Its IUPAC name is 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one |
| PubChem CID | 167859815 |
| Molecular Formula | C18H13FN2O2 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one |
| SMILES | O=C1NCCc2c1ccc(F)c2-c1ccc2ccc(=O)[nH]c2c1 |
| InChI | InChI=1S/C18H13FN2O2/c19-14-5-4-13-12(7-8-20-18(13)23)17(14)11-2-1-10-3-6-16(22)21-15(10)9-11/h1-6,9H,7-8H2,(H,20,23)(H,21,22) |
| InChIKey | WIBAAAJXNLKIMP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one?
The IUPAC name of 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one (CID 167859815) is 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one.
What is the SMILES notation for 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one?
The canonical SMILES for 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one is O=C1NCCc2c1ccc(F)c2-c1ccc2ccc(=O)[nH]c2c1.
What is the InChIKey of 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one?
The InChIKey is WIBAAAJXNLKIMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13FN2O2/c19-14-5-4-13-12(7-8-20-18(13)23)17(14)11-2-1-10-3-6-16(22)21-15(10)9-11/h1-6,9H,7-8H2,(H,20,23)(H,21,22).
What are the key properties of 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one?
7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one has a molecular weight of 308.31 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(6-fluoro-1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)-1H-quinolin-2-one is sourced from PubChem (CID 167859815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).