C18H21N3O2 — CID 167859869
(2S,3S)-N-(2H-chromen-3-ylmethyl)-2-(1-methylimidazol-2-yl)oxolan-3-amine (PubChem CID 167859869) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is (2S,3S)-N-(2H-chromen-3-ylmethyl)-2-(1-methylimidazol-2-yl)oxolan-3-amine.
| Compound Name | (2S,3S)-N-(2H-chromen-3-ylmethyl)-2-(1-methylimidazol-2-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 167859869 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | (2S,3S)-N-(2H-chromen-3-ylmethyl)-2-(1-methylimidazol-2-yl)oxolan-3-amine |
| SMILES | Cn1ccnc1[C@H]1OCC[C@@H]1NCC1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C18H21N3O2/c1-21-8-7-19-18(21)17-15(6-9-22-17)20-11-13-10-14-4-2-3-5-16(14)23-12-13/h2-5,7-8,10,15,17,20H,6,9,11-12H2,1H3/t15-,17-/m0/s1 |
| InChIKey | ZQTKSEZNWFWHII-RDJZCZTQSA-N |
| XLogP | 2.32 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |