C7H6Cl2N2O — CID 16786
3-amino-2,5-dichlorobenzamide (PubChem CID 16786) has the molecular formula C7H6Cl2N2O and a molecular weight of 205.04 g/mol. Its IUPAC name is 3-amino-2,5-dichlorobenzamide.
| Compound Name | 3-amino-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 16786 |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.04 g/mol |
| Exact Mass | 203.99 |
| IUPAC Name | 3-amino-2,5-dichlorobenzamide |
| SMILES | NC(=O)c1cc(Cl)cc(N)c1Cl |
| InChI | InChI=1S/C7H6Cl2N2O/c8-3-1-4(7(11)12)6(9)5(10)2-3/h1-2H,10H2,(H2,11,12) |
| InChIKey | JRYAPKWXBNUCKN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.04 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|